C28H26N2O2S — CID 42335660
(Z)-2-(1,3-benzothiazol-2-yl)-3-[4-[(4-tert-butylphenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile (PubChem CID 42335660) has the molecular formula C28H26N2O2S and a molecular weight of 454.60 g/mol. Its IUPAC name is (Z)-2-(1,3-benzothiazol-2-yl)-3-[4-[(4-tert-butylphenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile.
| Compound Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-[4-[(4-tert-butylphenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 42335660 |
| Molecular Formula | C28H26N2O2S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-[4-[(4-tert-butylphenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile |
| SMILES | COc1cc(/C=C(/C#N)c2nc3ccccc3s2)ccc1OCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H26N2O2S/c1-28(2,3)22-12-9-19(10-13-22)18-32-24-14-11-20(16-25(24)31-4)15-21(17-29)27-30-23-7-5-6-8-26(23)33-27/h5-16H,18H2,1-4H3/b21-15- |
| InChIKey | LWNFOOLSZBOEES-QNGOZBTKSA-N |
| XLogP | 7.25 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|