C23H15FN2OS — CID 2904010
2-(1,3-benzothiazol-2-yl)-3-[4-[(4-fluorophenyl)methoxy]phenyl]prop-2-enenitrile (PubChem CID 2904010) has the molecular formula C23H15FN2OS and a molecular weight of 386.45 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-3-[4-[(4-fluorophenyl)methoxy]phenyl]prop-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-3-[4-[(4-fluorophenyl)methoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 2904010 |
| Molecular Formula | C23H15FN2OS |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-3-[4-[(4-fluorophenyl)methoxy]phenyl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(OCc2ccc(F)cc2)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H15FN2OS/c24-19-9-5-17(6-10-19)15-27-20-11-7-16(8-12-20)13-18(14-25)23-26-21-3-1-2-4-22(21)28-23/h1-13H,15H2 |
| InChIKey | OSRPYTKIUJPLIH-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|