C16H5F5N2S — CID 4562591
2-(1,3-benzothiazol-2-yl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enenitrile (PubChem CID 4562591) has the molecular formula C16H5F5N2S and a molecular weight of 352.29 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4562591 |
| Molecular Formula | C16H5F5N2S |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1c(F)c(F)c(F)c(F)c1F)c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H5F5N2S/c17-11-8(12(18)14(20)15(21)13(11)19)5-7(6-22)16-23-9-3-1-2-4-10(9)24-16/h1-5H |
| InChIKey | BFDDKCSZTXLILQ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|