C16H8Br2N2OS — CID 2789974
2-(1,3-benzothiazol-2-yl)-3-(3,5-dibromo-4-hydroxyphenyl)prop-2-enenitrile (PubChem CID 2789974) has the molecular formula C16H8Br2N2OS and a molecular weight of 436.13 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-3-(3,5-dibromo-4-hydroxyphenyl)prop-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-3-(3,5-dibromo-4-hydroxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2789974 |
| Molecular Formula | C16H8Br2N2OS |
| Molecular Weight | 436.13 g/mol |
| Exact Mass | 433.87 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-3-(3,5-dibromo-4-hydroxyphenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1cc(Br)c(O)c(Br)c1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H8Br2N2OS/c17-11-6-9(7-12(18)15(11)21)5-10(8-19)16-20-13-3-1-2-4-14(13)22-16/h1-7,21H |
| InChIKey | VPGIEIDCERISKN-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.13 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|