C15H8BrN3S — CID 54613680
(E)-2-(1,3-benzothiazol-2-yl)-3-(3-bromo-4-pyridinyl)prop-2-enenitrile (PubChem CID 54613680) has the molecular formula C15H8BrN3S and a molecular weight of 342.22 g/mol. Its IUPAC name is (E)-2-(1,3-benzothiazol-2-yl)-3-(3-bromo-4-pyridinyl)prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzothiazol-2-yl)-3-(3-bromo-4-pyridinyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 54613680 |
| Molecular Formula | C15H8BrN3S |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 340.96 |
| IUPAC Name | (E)-2-(1,3-benzothiazol-2-yl)-3-(3-bromo-4-pyridinyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccncc1Br)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H8BrN3S/c16-12-9-18-6-5-10(12)7-11(8-17)15-19-13-3-1-2-4-14(13)20-15/h1-7,9H/b11-7+ |
| InChIKey | ZXRFIJADHSGTOY-YRNVUSSQSA-N |
| XLogP | 4.52 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|