C17H11BrN2O2S — CID 7515504
(E)-2-(1,3-benzothiazol-2-yl)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)prop-2-enenitrile (PubChem CID 7515504) has the molecular formula C17H11BrN2O2S and a molecular weight of 387.26 g/mol. Its IUPAC name is (E)-2-(1,3-benzothiazol-2-yl)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzothiazol-2-yl)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 7515504 |
| Molecular Formula | C17H11BrN2O2S |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 385.97 |
| IUPAC Name | (E)-2-(1,3-benzothiazol-2-yl)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)prop-2-enenitrile |
| SMILES | COc1cc(Br)c(/C=C(\C#N)c2nc3ccccc3s2)cc1O |
| InChI | InChI=1S/C17H11BrN2O2S/c1-22-15-8-12(18)10(7-14(15)21)6-11(9-19)17-20-13-4-2-3-5-16(13)23-17/h2-8,21H,1H3/b11-6+ |
| InChIKey | RVURWQRZUFOAQC-IZZDOVSWSA-N |
| XLogP | 4.84 |
| TPSA | 66.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|