C16H8BrClN2OS — CID 135900968
(E)-2-(1,3-benzothiazol-2-yl)-3-(5-bromo-3-chloro-2-hydroxyphenyl)prop-2-enenitrile (PubChem CID 135900968) has the molecular formula C16H8BrClN2OS and a molecular weight of 391.68 g/mol. Its IUPAC name is (E)-2-(1,3-benzothiazol-2-yl)-3-(5-bromo-3-chloro-2-hydroxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzothiazol-2-yl)-3-(5-bromo-3-chloro-2-hydroxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135900968 |
| Molecular Formula | C16H8BrClN2OS |
| Molecular Weight | 391.68 g/mol |
| Exact Mass | 389.92 |
| IUPAC Name | (E)-2-(1,3-benzothiazol-2-yl)-3-(5-bromo-3-chloro-2-hydroxyphenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(Br)cc(Cl)c1O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H8BrClN2OS/c17-11-6-9(15(21)12(18)7-11)5-10(8-19)16-20-13-3-1-2-4-14(13)22-16/h1-7,21H/b10-5+ |
| InChIKey | HIICRKRGBRUYKN-BJMVGYQFSA-N |
| XLogP | 5.48 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.68 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|