C15H7Cl2N3OS — CID 135625989
N-(3,5-dichloro-4-hydroxyphenyl)-1,3-benzothiazole-2-carboximidoyl cyanide (PubChem CID 135625989) has the molecular formula C15H7Cl2N3OS and a molecular weight of 348.21 g/mol. Its IUPAC name is N-(3,5-dichloro-4-hydroxyphenyl)-1,3-benzothiazole-2-carboximidoyl cyanide.
| Compound Name | N-(3,5-dichloro-4-hydroxyphenyl)-1,3-benzothiazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 135625989 |
| Molecular Formula | C15H7Cl2N3OS |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 346.97 |
| IUPAC Name | N-(3,5-dichloro-4-hydroxyphenyl)-1,3-benzothiazole-2-carboximidoyl cyanide |
| SMILES | N#C/C(=N\c1cc(Cl)c(O)c(Cl)c1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H7Cl2N3OS/c16-9-5-8(6-10(17)14(9)21)19-12(7-18)15-20-11-3-1-2-4-13(11)22-15/h1-6,21H/b19-12+ |
| InChIKey | SHINHLYQZPDHBB-XDHOZWIPSA-N |
| XLogP | 4.95 |
| TPSA | 69.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|