C15H10N4O3S2 — CID 2753523
4-[2-[1,3-benzothiazol-2-yl(cyano)methylidene]hydrazinyl]benzenesulfonic acid (PubChem CID 2753523) has the molecular formula C15H10N4O3S2 and a molecular weight of 358.40 g/mol. Its IUPAC name is 4-[2-[1,3-benzothiazol-2-yl(cyano)methylidene]hydrazinyl]benzenesulfonic acid.
| Compound Name | 4-[2-[1,3-benzothiazol-2-yl(cyano)methylidene]hydrazinyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 2753523 |
| Molecular Formula | C15H10N4O3S2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 4-[2-[1,3-benzothiazol-2-yl(cyano)methylidene]hydrazinyl]benzenesulfonic acid |
| SMILES | N#CC(=NNc1ccc(S(=O)(=O)O)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H10N4O3S2/c16-9-13(15-17-12-3-1-2-4-14(12)23-15)19-18-10-5-7-11(8-6-10)24(20,21)22/h1-8,18H,(H,20,21,22) |
| InChIKey | MMJPRTHFLGOVBZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|