C16H9N5S2 — CID 169339731
2-[[4-(1,3-benzothiazol-2-ylsulfanyl)phenyl]hydrazinylidene]propanedinitrile (PubChem CID 169339731) has the molecular formula C16H9N5S2 and a molecular weight of 335.42 g/mol. Its IUPAC name is 2-[[4-(1,3-benzothiazol-2-ylsulfanyl)phenyl]hydrazinylidene]propanedinitrile.
| Compound Name | 2-[[4-(1,3-benzothiazol-2-ylsulfanyl)phenyl]hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169339731 |
| Molecular Formula | C16H9N5S2 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 2-[[4-(1,3-benzothiazol-2-ylsulfanyl)phenyl]hydrazinylidene]propanedinitrile |
| SMILES | N#CC(C#N)=NNc1ccc(Sc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C16H9N5S2/c17-9-12(10-18)21-20-11-5-7-13(8-6-11)22-16-19-14-3-1-2-4-15(14)23-16/h1-8,20H |
| InChIKey | XATXMKVERWFYNP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|