C20H13F2N3OS2 — CID 163364545
1-[4-(1,3-benzothiazol-2-ylsulfanyl)phenyl]-3-(3,4-difluorophenyl)urea (PubChem CID 163364545) has the molecular formula C20H13F2N3OS2 and a molecular weight of 413.47 g/mol. Its IUPAC name is 1-[4-(1,3-benzothiazol-2-ylsulfanyl)phenyl]-3-(3,4-difluorophenyl)urea.
| Compound Name | 1-[4-(1,3-benzothiazol-2-ylsulfanyl)phenyl]-3-(3,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 163364545 |
| Molecular Formula | C20H13F2N3OS2 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 1-[4-(1,3-benzothiazol-2-ylsulfanyl)phenyl]-3-(3,4-difluorophenyl)urea |
| SMILES | O=C(Nc1ccc(Sc2nc3ccccc3s2)cc1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H13F2N3OS2/c21-15-10-7-13(11-16(15)22)24-19(26)23-12-5-8-14(9-6-12)27-20-25-17-3-1-2-4-18(17)28-20/h1-11H,(H2,23,24,26) |
| InChIKey | ONYWCTDOMYLGPI-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |