C15H13NOS2 — CID 63814574
1-[4-(1,3-benzothiazol-2-ylsulfanyl)phenyl]ethanol (PubChem CID 63814574) has the molecular formula C15H13NOS2 and a molecular weight of 287.41 g/mol. Its IUPAC name is 1-[4-(1,3-benzothiazol-2-ylsulfanyl)phenyl]ethanol.
| Compound Name | 1-[4-(1,3-benzothiazol-2-ylsulfanyl)phenyl]ethanol |
|---|---|
| PubChem CID | 63814574 |
| Molecular Formula | C15H13NOS2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 1-[4-(1,3-benzothiazol-2-ylsulfanyl)phenyl]ethanol |
| SMILES | CC(O)c1ccc(Sc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C15H13NOS2/c1-10(17)11-6-8-12(9-7-11)18-15-16-13-4-2-3-5-14(13)19-15/h2-10,17H,1H3 |
| InChIKey | DBKAMUYHMKPSKX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |