C15H12N2OS2 — CID 115939134
1-[5-(1,3-benzothiazol-2-ylsulfanyl)-2-pyridinyl]propan-1-one (PubChem CID 115939134) has the molecular formula C15H12N2OS2 and a molecular weight of 300.41 g/mol. Its IUPAC name is 1-[5-(1,3-benzothiazol-2-ylsulfanyl)-2-pyridinyl]propan-1-one.
| Compound Name | 1-[5-(1,3-benzothiazol-2-ylsulfanyl)-2-pyridinyl]propan-1-one |
|---|---|
| PubChem CID | 115939134 |
| Molecular Formula | C15H12N2OS2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 1-[5-(1,3-benzothiazol-2-ylsulfanyl)-2-pyridinyl]propan-1-one |
| SMILES | CCC(=O)c1ccc(Sc2nc3ccccc3s2)cn1 |
| InChI | InChI=1S/C15H12N2OS2/c1-2-13(18)11-8-7-10(9-16-11)19-15-17-12-5-3-4-6-14(12)20-15/h3-9H,2H2,1H3 |
| InChIKey | TYTREQCETALTAT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |