C15H14N2OS2 — CID 115941653
1-[5-(1,3-benzothiazol-2-ylsulfanyl)-2-pyridinyl]propan-1-ol (PubChem CID 115941653) has the molecular formula C15H14N2OS2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 1-[5-(1,3-benzothiazol-2-ylsulfanyl)-2-pyridinyl]propan-1-ol.
| Compound Name | 1-[5-(1,3-benzothiazol-2-ylsulfanyl)-2-pyridinyl]propan-1-ol |
|---|---|
| PubChem CID | 115941653 |
| Molecular Formula | C15H14N2OS2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 1-[5-(1,3-benzothiazol-2-ylsulfanyl)-2-pyridinyl]propan-1-ol |
| SMILES | CCC(O)c1ccc(Sc2nc3ccccc3s2)cn1 |
| InChI | InChI=1S/C15H14N2OS2/c1-2-13(18)11-8-7-10(9-16-11)19-15-17-12-5-3-4-6-14(12)20-15/h3-9,13,18H,2H2,1H3 |
| InChIKey | XXPHVNJYJLXYIL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |