C14H11FN2OS — CID 79819016
2-(1,3-benzothiazol-2-yl)-1-(5-fluoro-2-pyridinyl)ethanol (PubChem CID 79819016) has the molecular formula C14H11FN2OS and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-1-(5-fluoro-2-pyridinyl)ethanol.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-1-(5-fluoro-2-pyridinyl)ethanol |
|---|---|
| PubChem CID | 79819016 |
| Molecular Formula | C14H11FN2OS |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-1-(5-fluoro-2-pyridinyl)ethanol |
| SMILES | OC(Cc1nc2ccccc2s1)c1ccc(F)cn1 |
| InChI | InChI=1S/C14H11FN2OS/c15-9-5-6-10(16-8-9)12(18)7-14-17-11-3-1-2-4-13(11)19-14/h1-6,8,12,18H,7H2 |
| InChIKey | NWCXNMLPDDGQQT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |