C16H15NOS2 — CID 79205491
2-(1,3-benzothiazol-2-yl)-1-(2-methylsulfanylphenyl)ethanol (PubChem CID 79205491) has the molecular formula C16H15NOS2 and a molecular weight of 301.44 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-1-(2-methylsulfanylphenyl)ethanol.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-1-(2-methylsulfanylphenyl)ethanol |
|---|---|
| PubChem CID | 79205491 |
| Molecular Formula | C16H15NOS2 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-1-(2-methylsulfanylphenyl)ethanol |
| SMILES | CSc1ccccc1C(O)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H15NOS2/c1-19-14-8-4-2-6-11(14)13(18)10-16-17-12-7-3-5-9-15(12)20-16/h2-9,13,18H,10H2,1H3 |
| InChIKey | LPZVHSDDFOGVPS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |