C13H10ClNOS2 — CID 66461877
2-(1,3-benzothiazol-2-yl)-1-(5-chlorothiophen-2-yl)ethanol (PubChem CID 66461877) has the molecular formula C13H10ClNOS2 and a molecular weight of 295.82 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-1-(5-chlorothiophen-2-yl)ethanol.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-1-(5-chlorothiophen-2-yl)ethanol |
|---|---|
| PubChem CID | 66461877 |
| Molecular Formula | C13H10ClNOS2 |
| Molecular Weight | 295.82 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-1-(5-chlorothiophen-2-yl)ethanol |
| SMILES | OC(Cc1nc2ccccc2s1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H10ClNOS2/c14-12-6-5-11(17-12)9(16)7-13-15-8-3-1-2-4-10(8)18-13/h1-6,9,16H,7H2 |
| InChIKey | FJKVLRHOQUKSTQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.82 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |