C14H13NOS2 — CID 79818416
2-(1,3-benzothiazol-2-yl)-1-(4-methylthiophen-3-yl)ethanol (PubChem CID 79818416) has the molecular formula C14H13NOS2 and a molecular weight of 275.40 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-1-(4-methylthiophen-3-yl)ethanol.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-1-(4-methylthiophen-3-yl)ethanol |
|---|---|
| PubChem CID | 79818416 |
| Molecular Formula | C14H13NOS2 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-1-(4-methylthiophen-3-yl)ethanol |
| SMILES | Cc1cscc1C(O)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H13NOS2/c1-9-7-17-8-10(9)12(16)6-14-15-11-4-2-3-5-13(11)18-14/h2-5,7-8,12,16H,6H2,1H3 |
| InChIKey | BRTDKJQSXNIYJY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |