C18H19NOS — CID 79826149
1-(1,3-benzothiazol-2-yl)-3-(3,5-dimethylphenyl)propan-2-ol (PubChem CID 79826149) has the molecular formula C18H19NOS and a molecular weight of 297.42 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-(3,5-dimethylphenyl)propan-2-ol.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-(3,5-dimethylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 79826149 |
| Molecular Formula | C18H19NOS |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-(3,5-dimethylphenyl)propan-2-ol |
| SMILES | Cc1cc(C)cc(CC(O)Cc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C18H19NOS/c1-12-7-13(2)9-14(8-12)10-15(20)11-18-19-16-5-3-4-6-17(16)21-18/h3-9,15,20H,10-11H2,1-2H3 |
| InChIKey | URCLOGZWZBLYRC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |