C16H15NO2S — CID 103459476
3-(1,3-benzothiazol-2-yl)-1-phenylpropane-1,2-diol (PubChem CID 103459476) has the molecular formula C16H15NO2S and a molecular weight of 285.37 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-1-phenylpropane-1,2-diol.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-1-phenylpropane-1,2-diol |
|---|---|
| PubChem CID | 103459476 |
| Molecular Formula | C16H15NO2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-1-phenylpropane-1,2-diol |
| SMILES | OC(Cc1nc2ccccc2s1)C(O)c1ccccc1 |
| InChI | InChI=1S/C16H15NO2S/c18-13(16(19)11-6-2-1-3-7-11)10-15-17-12-8-4-5-9-14(12)20-15/h1-9,13,16,18-19H,10H2 |
| InChIKey | GNUMVJXZCZAXRK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |