C13H13N3OS — CID 79819245
2-(1,3-benzothiazol-2-yl)-1-(3-methylimidazol-4-yl)ethanol (PubChem CID 79819245) has the molecular formula C13H13N3OS and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-1-(3-methylimidazol-4-yl)ethanol.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-1-(3-methylimidazol-4-yl)ethanol |
|---|---|
| PubChem CID | 79819245 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-1-(3-methylimidazol-4-yl)ethanol |
| SMILES | Cn1cncc1C(O)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H13N3OS/c1-16-8-14-7-10(16)11(17)6-13-15-9-4-2-3-5-12(9)18-13/h2-5,7-8,11,17H,6H2,1H3 |
| InChIKey | WVOVSZJSDRDVAJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |