C10H8FNO2S — CID 79819155
3-(1,3-benzothiazol-2-yl)-2-fluoropropanoic acid (PubChem CID 79819155) has the molecular formula C10H8FNO2S and a molecular weight of 225.24 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-2-fluoropropanoic acid.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-2-fluoropropanoic acid |
|---|---|
| PubChem CID | 79819155 |
| Molecular Formula | C10H8FNO2S |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-2-fluoropropanoic acid |
| SMILES | O=C(O)C(F)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C10H8FNO2S/c11-6(10(13)14)5-9-12-7-3-1-2-4-8(7)15-9/h1-4,6H,5H2,(H,13,14) |
| InChIKey | PCIPKTREPXKBHX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |