C12H14N2O2S — CID 104680893
4-amino-2-(1,3-benzothiazol-2-ylmethyl)butanoic acid (PubChem CID 104680893) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 4-amino-2-(1,3-benzothiazol-2-ylmethyl)butanoic acid.
| Compound Name | 4-amino-2-(1,3-benzothiazol-2-ylmethyl)butanoic acid |
|---|---|
| PubChem CID | 104680893 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 4-amino-2-(1,3-benzothiazol-2-ylmethyl)butanoic acid |
| SMILES | NCCC(Cc1nc2ccccc2s1)C(=O)O |
| InChI | InChI=1S/C12H14N2O2S/c13-6-5-8(12(15)16)7-11-14-9-3-1-2-4-10(9)17-11/h1-4,8H,5-7,13H2,(H,15,16) |
| InChIKey | YHKAUKKJVYNQJX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |