C12H13NO2S — CID 69373746
4-(1,3-benzothiazol-2-yl)-2-methylbutanoic acid (PubChem CID 69373746) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-2-methylbutanoic acid.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-2-methylbutanoic acid |
|---|---|
| PubChem CID | 69373746 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-2-methylbutanoic acid |
| SMILES | CC(CCc1nc2ccccc2s1)C(=O)O |
| InChI | InChI=1S/C12H13NO2S/c1-8(12(14)15)6-7-11-13-9-4-2-3-5-10(9)16-11/h2-5,8H,6-7H2,1H3,(H,14,15) |
| InChIKey | JJHJLJSIMBEUOE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |