C14H17N3O3S — CID 123251133
2-amino-5-[2-(1,3-benzothiazol-2-yl)ethylamino]-5-oxopentanoic acid (PubChem CID 123251133) has the molecular formula C14H17N3O3S and a molecular weight of 307.37 g/mol. Its IUPAC name is 2-amino-5-[2-(1,3-benzothiazol-2-yl)ethylamino]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[2-(1,3-benzothiazol-2-yl)ethylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 123251133 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-amino-5-[2-(1,3-benzothiazol-2-yl)ethylamino]-5-oxopentanoic acid |
| SMILES | NC(CCC(=O)NCCc1nc2ccccc2s1)C(=O)O |
| InChI | InChI=1S/C14H17N3O3S/c15-9(14(19)20)5-6-12(18)16-8-7-13-17-10-3-1-2-4-11(10)21-13/h1-4,9H,5-8,15H2,(H,16,18)(H,19,20) |
| InChIKey | IIWHZTUJPVADJO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |