C12H15N3OS — CID 114996265
N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-(methylamino)acetamide (PubChem CID 114996265) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-(methylamino)acetamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 114996265 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-(methylamino)acetamide |
| SMILES | CNCC(=O)NCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H15N3OS/c1-13-8-11(16)14-7-6-12-15-9-4-2-3-5-10(9)17-12/h2-5,13H,6-8H2,1H3,(H,14,16) |
| InChIKey | UAADNOKKVPGRSP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |