C17H14Cl2N2OS — CID 9464682
N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-(2,6-dichlorophenyl)acetamide (PubChem CID 9464682) has the molecular formula C17H14Cl2N2OS and a molecular weight of 365.29 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-(2,6-dichlorophenyl)acetamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-(2,6-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 9464682 |
| Molecular Formula | C17H14Cl2N2OS |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-(2,6-dichlorophenyl)acetamide |
| SMILES | O=C(Cc1c(Cl)cccc1Cl)NCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H14Cl2N2OS/c18-12-4-3-5-13(19)11(12)10-16(22)20-9-8-17-21-14-6-1-2-7-15(14)23-17/h1-7H,8-10H2,(H,20,22) |
| InChIKey | OLDVNPZOLCMKPD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |