C20H20ClN3O2S — CID 46823942
N-[4-[2-(1,3-benzothiazol-2-yl)ethylamino]-4-oxobutyl]-4-chlorobenzamide (PubChem CID 46823942) has the molecular formula C20H20ClN3O2S and a molecular weight of 401.92 g/mol. Its IUPAC name is N-[4-[2-(1,3-benzothiazol-2-yl)ethylamino]-4-oxobutyl]-4-chlorobenzamide.
| Compound Name | N-[4-[2-(1,3-benzothiazol-2-yl)ethylamino]-4-oxobutyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 46823942 |
| Molecular Formula | C20H20ClN3O2S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | N-[4-[2-(1,3-benzothiazol-2-yl)ethylamino]-4-oxobutyl]-4-chlorobenzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(Cl)cc1)NCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C20H20ClN3O2S/c21-15-9-7-14(8-10-15)20(26)23-12-3-6-18(25)22-13-11-19-24-16-4-1-2-5-17(16)27-19/h1-2,4-5,7-10H,3,6,11-13H2,(H,22,25)(H,23,26) |
| InChIKey | FUCVZNCDUYGLNK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|