C13H16ClN3OS — CID 119275972
4-amino-N-[2-(5-chloro-1,3-benzothiazol-2-yl)ethyl]butanamide (PubChem CID 119275972) has the molecular formula C13H16ClN3OS and a molecular weight of 297.81 g/mol. Its IUPAC name is 4-amino-N-[2-(5-chloro-1,3-benzothiazol-2-yl)ethyl]butanamide.
| Compound Name | 4-amino-N-[2-(5-chloro-1,3-benzothiazol-2-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 119275972 |
| Molecular Formula | C13H16ClN3OS |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 4-amino-N-[2-(5-chloro-1,3-benzothiazol-2-yl)ethyl]butanamide |
| SMILES | NCCCC(=O)NCCc1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C13H16ClN3OS/c14-9-3-4-11-10(8-9)17-13(19-11)5-7-16-12(18)2-1-6-15/h3-4,8H,1-2,5-7,15H2,(H,16,18) |
| InChIKey | GVPHXLSDWBVIEG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |