C14H18ClN3OS — CID 119698347
N-[2-(5-chloro-1,3-benzothiazol-2-yl)ethyl]-4-(methylamino)butanamide (PubChem CID 119698347) has the molecular formula C14H18ClN3OS and a molecular weight of 311.84 g/mol. Its IUPAC name is N-[2-(5-chloro-1,3-benzothiazol-2-yl)ethyl]-4-(methylamino)butanamide.
| Compound Name | N-[2-(5-chloro-1,3-benzothiazol-2-yl)ethyl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 119698347 |
| Molecular Formula | C14H18ClN3OS |
| Molecular Weight | 311.84 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-[2-(5-chloro-1,3-benzothiazol-2-yl)ethyl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)NCCc1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C14H18ClN3OS/c1-16-7-2-3-13(19)17-8-6-14-18-11-9-10(15)4-5-12(11)20-14/h4-5,9,16H,2-3,6-8H2,1H3,(H,17,19) |
| InChIKey | IPSLSRNBXUEHHQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.84 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|