C14H17ClN4S — CID 119117832
1-[2-(5-chloro-1,3-benzothiazol-2-yl)ethyl]-2-(2-methylprop-2-enyl)guanidine (PubChem CID 119117832) has the molecular formula C14H17ClN4S and a molecular weight of 308.84 g/mol. Its IUPAC name is 1-[2-(5-chloro-1,3-benzothiazol-2-yl)ethyl]-2-(2-methylprop-2-enyl)guanidine.
| Compound Name | 1-[2-(5-chloro-1,3-benzothiazol-2-yl)ethyl]-2-(2-methylprop-2-enyl)guanidine |
|---|---|
| PubChem CID | 119117832 |
| Molecular Formula | C14H17ClN4S |
| Molecular Weight | 308.84 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 1-[2-(5-chloro-1,3-benzothiazol-2-yl)ethyl]-2-(2-methylprop-2-enyl)guanidine |
| SMILES | C=C(C)C/N=C(\N)NCCc1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C14H17ClN4S/c1-9(2)8-18-14(16)17-6-5-13-19-11-7-10(15)3-4-12(11)20-13/h3-4,7H,1,5-6,8H2,2H3,(H3,16,17,18) |
| InChIKey | DTJQRZTYZGVREB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.84 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|