C17H15ClN2O2S — CID 43069942
N-[3-(1,3-benzothiazol-2-yl)propyl]-5-chloro-2-hydroxybenzamide (PubChem CID 43069942) has the molecular formula C17H15ClN2O2S and a molecular weight of 346.84 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)propyl]-5-chloro-2-hydroxybenzamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-5-chloro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 43069942 |
| Molecular Formula | C17H15ClN2O2S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-5-chloro-2-hydroxybenzamide |
| SMILES | O=C(NCCCc1nc2ccccc2s1)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C17H15ClN2O2S/c18-11-7-8-14(21)12(10-11)17(22)19-9-3-6-16-20-13-4-1-2-5-15(13)23-16/h1-2,4-5,7-8,10,21H,3,6,9H2,(H,19,22) |
| InChIKey | SOUFKMRCHLNOKA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|