C17H18N2OS2 — CID 38901273
N-[3-(1,3-benzothiazol-2-yl)propyl]-2,5-dimethylthiophene-3-carboxamide (PubChem CID 38901273) has the molecular formula C17H18N2OS2 and a molecular weight of 330.48 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)propyl]-2,5-dimethylthiophene-3-carboxamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-2,5-dimethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 38901273 |
| Molecular Formula | C17H18N2OS2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-2,5-dimethylthiophene-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCc2nc3ccccc3s2)c(C)s1 |
| InChI | InChI=1S/C17H18N2OS2/c1-11-10-13(12(2)21-11)17(20)18-9-5-8-16-19-14-6-3-4-7-15(14)22-16/h3-4,6-7,10H,5,8-9H2,1-2H3,(H,18,20) |
| InChIKey | BPFORUZCXOZIAS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|