C19H17N3OS3 — CID 41247806
N-[3-(1,3-benzothiazol-2-yl)propyl]-4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxamide (PubChem CID 41247806) has the molecular formula C19H17N3OS3 and a molecular weight of 399.57 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)propyl]-4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 41247806 |
| Molecular Formula | C19H17N3OS3 |
| Molecular Weight | 399.57 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2cccs2)sc1C(=O)NCCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C19H17N3OS3/c1-12-17(26-19(21-12)15-8-5-11-24-15)18(23)20-10-4-9-16-22-13-6-2-3-7-14(13)25-16/h2-3,5-8,11H,4,9-10H2,1H3,(H,20,23) |
| InChIKey | YODRIXFKSUHALV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|