C19H14N4O2S2 — CID 35065301
4-methyl-N'-(quinoline-2-carbonyl)-2-thiophen-2-yl-1,3-thiazole-5-carbohydrazide (PubChem CID 35065301) has the molecular formula C19H14N4O2S2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 4-methyl-N'-(quinoline-2-carbonyl)-2-thiophen-2-yl-1,3-thiazole-5-carbohydrazide.
| Compound Name | 4-methyl-N'-(quinoline-2-carbonyl)-2-thiophen-2-yl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 35065301 |
| Molecular Formula | C19H14N4O2S2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 4-methyl-N'-(quinoline-2-carbonyl)-2-thiophen-2-yl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(-c2cccs2)sc1C(=O)NNC(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C19H14N4O2S2/c1-11-16(27-19(20-11)15-7-4-10-26-15)18(25)23-22-17(24)14-9-8-12-5-2-3-6-13(12)21-14/h2-10H,1H3,(H,22,24)(H,23,25) |
| InChIKey | HOVVVYBCPCTUCH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|