C20H17N5O3S2 — CID 27564090
N'-(3-ethyl-4-oxophthalazine-1-carbonyl)-4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carbohydrazide (PubChem CID 27564090) has the molecular formula C20H17N5O3S2 and a molecular weight of 439.52 g/mol. Its IUPAC name is N'-(3-ethyl-4-oxophthalazine-1-carbonyl)-4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-(3-ethyl-4-oxophthalazine-1-carbonyl)-4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 27564090 |
| Molecular Formula | C20H17N5O3S2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | N'-(3-ethyl-4-oxophthalazine-1-carbonyl)-4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carbohydrazide |
| SMILES | CCn1nc(C(=O)NNC(=O)c2sc(-c3cccs3)nc2C)c2ccccc2c1=O |
| InChI | InChI=1S/C20H17N5O3S2/c1-3-25-20(28)13-8-5-4-7-12(13)15(24-25)17(26)22-23-18(27)16-11(2)21-19(30-16)14-9-6-10-29-14/h4-10H,3H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | JSYUWJLSFBFOCF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|