C20H20N4O5 — CID 2674005
N'-(3,5-dimethoxybenzoyl)-3-ethyl-4-oxophthalazine-1-carbohydrazide (PubChem CID 2674005) has the molecular formula C20H20N4O5 and a molecular weight of 396.40 g/mol. Its IUPAC name is N'-(3,5-dimethoxybenzoyl)-3-ethyl-4-oxophthalazine-1-carbohydrazide.
| Compound Name | N'-(3,5-dimethoxybenzoyl)-3-ethyl-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 2674005 |
| Molecular Formula | C20H20N4O5 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | N'-(3,5-dimethoxybenzoyl)-3-ethyl-4-oxophthalazine-1-carbohydrazide |
| SMILES | CCn1nc(C(=O)NNC(=O)c2cc(OC)cc(OC)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C20H20N4O5/c1-4-24-20(27)16-8-6-5-7-15(16)17(23-24)19(26)22-21-18(25)12-9-13(28-2)11-14(10-12)29-3/h5-11H,4H2,1-3H3,(H,21,25)(H,22,26) |
| InChIKey | ZCTKFOXVJFNMML-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|