C26H24N4O5 — CID 27563734
3-ethyl-N'-(3-methoxy-4-phenylmethoxybenzoyl)-4-oxophthalazine-1-carbohydrazide (PubChem CID 27563734) has the molecular formula C26H24N4O5 and a molecular weight of 472.50 g/mol. Its IUPAC name is 3-ethyl-N'-(3-methoxy-4-phenylmethoxybenzoyl)-4-oxophthalazine-1-carbohydrazide.
| Compound Name | 3-ethyl-N'-(3-methoxy-4-phenylmethoxybenzoyl)-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 27563734 |
| Molecular Formula | C26H24N4O5 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 3-ethyl-N'-(3-methoxy-4-phenylmethoxybenzoyl)-4-oxophthalazine-1-carbohydrazide |
| SMILES | CCn1nc(C(=O)NNC(=O)c2ccc(OCc3ccccc3)c(OC)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C26H24N4O5/c1-3-30-26(33)20-12-8-7-11-19(20)23(29-30)25(32)28-27-24(31)18-13-14-21(22(15-18)34-2)35-16-17-9-5-4-6-10-17/h4-15H,3,16H2,1-2H3,(H,27,31)(H,28,32) |
| InChIKey | JBJIOOPADWQJOG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|