C20H15ClN4O3S — CID 27563829
N'-(3-chloro-1-benzothiophene-2-carbonyl)-3-ethyl-4-oxophthalazine-1-carbohydrazide (PubChem CID 27563829) has the molecular formula C20H15ClN4O3S and a molecular weight of 426.89 g/mol. Its IUPAC name is N'-(3-chloro-1-benzothiophene-2-carbonyl)-3-ethyl-4-oxophthalazine-1-carbohydrazide.
| Compound Name | N'-(3-chloro-1-benzothiophene-2-carbonyl)-3-ethyl-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 27563829 |
| Molecular Formula | C20H15ClN4O3S |
| Molecular Weight | 426.89 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | N'-(3-chloro-1-benzothiophene-2-carbonyl)-3-ethyl-4-oxophthalazine-1-carbohydrazide |
| SMILES | CCn1nc(C(=O)NNC(=O)c2sc3ccccc3c2Cl)c2ccccc2c1=O |
| InChI | InChI=1S/C20H15ClN4O3S/c1-2-25-20(28)12-8-4-3-7-11(12)16(24-25)18(26)22-23-19(27)17-15(21)13-9-5-6-10-14(13)29-17/h3-10H,2H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | GGTWJYGEUPVTIP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.89 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|