C22H18ClN5O3S — CID 26771539
2-(3-chlorophenyl)-N'-(3-ethyl-4-oxophthalazine-1-carbonyl)-4-methyl-1,3-thiazole-5-carbohydrazide (PubChem CID 26771539) has the molecular formula C22H18ClN5O3S and a molecular weight of 467.94 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N'-(3-ethyl-4-oxophthalazine-1-carbonyl)-4-methyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | 2-(3-chlorophenyl)-N'-(3-ethyl-4-oxophthalazine-1-carbonyl)-4-methyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 26771539 |
| Molecular Formula | C22H18ClN5O3S |
| Molecular Weight | 467.94 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 2-(3-chlorophenyl)-N'-(3-ethyl-4-oxophthalazine-1-carbonyl)-4-methyl-1,3-thiazole-5-carbohydrazide |
| SMILES | CCn1nc(C(=O)NNC(=O)c2sc(-c3cccc(Cl)c3)nc2C)c2ccccc2c1=O |
| InChI | InChI=1S/C22H18ClN5O3S/c1-3-28-22(31)16-10-5-4-9-15(16)17(27-28)19(29)25-26-20(30)18-12(2)24-21(32-18)13-7-6-8-14(23)11-13/h4-11H,3H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | FZTJNSQTCDYQIN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.94 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|