C19H16Cl2N4O3 — CID 4806048
N'-[2-(2,4-dichlorophenyl)acetyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide (PubChem CID 4806048) has the molecular formula C19H16Cl2N4O3 and a molecular weight of 419.27 g/mol. Its IUPAC name is N'-[2-(2,4-dichlorophenyl)acetyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide.
| Compound Name | N'-[2-(2,4-dichlorophenyl)acetyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 4806048 |
| Molecular Formula | C19H16Cl2N4O3 |
| Molecular Weight | 419.27 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | N'-[2-(2,4-dichlorophenyl)acetyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide |
| SMILES | CCn1nc(C(=O)NNC(=O)Cc2ccc(Cl)cc2Cl)c2ccccc2c1=O |
| InChI | InChI=1S/C19H16Cl2N4O3/c1-2-25-19(28)14-6-4-3-5-13(14)17(24-25)18(27)23-22-16(26)9-11-7-8-12(20)10-15(11)21/h3-8,10H,2,9H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | BBZFJPUCBCMJFR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|