C17H14Cl2N4O4S — CID 2080680
N'-(2,5-dichlorophenyl)sulfonyl-3-ethyl-4-oxophthalazine-1-carbohydrazide (PubChem CID 2080680) has the molecular formula C17H14Cl2N4O4S and a molecular weight of 441.30 g/mol. Its IUPAC name is N'-(2,5-dichlorophenyl)sulfonyl-3-ethyl-4-oxophthalazine-1-carbohydrazide.
| Compound Name | N'-(2,5-dichlorophenyl)sulfonyl-3-ethyl-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 2080680 |
| Molecular Formula | C17H14Cl2N4O4S |
| Molecular Weight | 441.30 g/mol |
| Exact Mass | 440.01 |
| IUPAC Name | N'-(2,5-dichlorophenyl)sulfonyl-3-ethyl-4-oxophthalazine-1-carbohydrazide |
| SMILES | CCn1nc(C(=O)NNS(=O)(=O)c2cc(Cl)ccc2Cl)c2ccccc2c1=O |
| InChI | InChI=1S/C17H14Cl2N4O4S/c1-2-23-17(25)12-6-4-3-5-11(12)15(21-23)16(24)20-22-28(26,27)14-9-10(18)7-8-13(14)19/h3-9,22H,2H2,1H3,(H,20,24) |
| InChIKey | DQJXBSTTXMVBQI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|