C20H18Cl2N4O3 — CID 46577629
N'-[3-(2,4-dichlorophenyl)propanoyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide (PubChem CID 46577629) has the molecular formula C20H18Cl2N4O3 and a molecular weight of 433.30 g/mol. Its IUPAC name is N'-[3-(2,4-dichlorophenyl)propanoyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide.
| Compound Name | N'-[3-(2,4-dichlorophenyl)propanoyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 46577629 |
| Molecular Formula | C20H18Cl2N4O3 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | N'-[3-(2,4-dichlorophenyl)propanoyl]-3-ethyl-4-oxophthalazine-1-carbohydrazide |
| SMILES | CCn1nc(C(=O)NNC(=O)CCc2ccc(Cl)cc2Cl)c2ccccc2c1=O |
| InChI | InChI=1S/C20H18Cl2N4O3/c1-2-26-20(29)15-6-4-3-5-14(15)18(25-26)19(28)24-23-17(27)10-8-12-7-9-13(21)11-16(12)22/h3-7,9,11H,2,8,10H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | TUFNBDXFRDYJGP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|