C24H27ClN4O3 — CID 55788932
N'-[4-(4-chlorophenyl)butanoyl]-4-oxo-3-pentylphthalazine-1-carbohydrazide (PubChem CID 55788932) has the molecular formula C24H27ClN4O3 and a molecular weight of 454.96 g/mol. Its IUPAC name is N'-[4-(4-chlorophenyl)butanoyl]-4-oxo-3-pentylphthalazine-1-carbohydrazide.
| Compound Name | N'-[4-(4-chlorophenyl)butanoyl]-4-oxo-3-pentylphthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 55788932 |
| Molecular Formula | C24H27ClN4O3 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | N'-[4-(4-chlorophenyl)butanoyl]-4-oxo-3-pentylphthalazine-1-carbohydrazide |
| SMILES | CCCCCn1nc(C(=O)NNC(=O)CCCc2ccc(Cl)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C24H27ClN4O3/c1-2-3-6-16-29-24(32)20-10-5-4-9-19(20)22(28-29)23(31)27-26-21(30)11-7-8-17-12-14-18(25)15-13-17/h4-5,9-10,12-15H,2-3,6-8,11,16H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | XRXWDMKTUDEUDG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|