C23H24Cl2N4O4 — CID 55788848
N'-[3-(2,3-dichlorophenoxy)propanoyl]-4-oxo-3-pentylphthalazine-1-carbohydrazide (PubChem CID 55788848) has the molecular formula C23H24Cl2N4O4 and a molecular weight of 491.38 g/mol. Its IUPAC name is N'-[3-(2,3-dichlorophenoxy)propanoyl]-4-oxo-3-pentylphthalazine-1-carbohydrazide.
| Compound Name | N'-[3-(2,3-dichlorophenoxy)propanoyl]-4-oxo-3-pentylphthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 55788848 |
| Molecular Formula | C23H24Cl2N4O4 |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | N'-[3-(2,3-dichlorophenoxy)propanoyl]-4-oxo-3-pentylphthalazine-1-carbohydrazide |
| SMILES | CCCCCn1nc(C(=O)NNC(=O)CCOc2cccc(Cl)c2Cl)c2ccccc2c1=O |
| InChI | InChI=1S/C23H24Cl2N4O4/c1-2-3-6-13-29-23(32)16-9-5-4-8-15(16)21(28-29)22(31)27-26-19(30)12-14-33-18-11-7-10-17(24)20(18)25/h4-5,7-11H,2-3,6,12-14H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | MFMUNPKEKBTOAQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|