C24H24ClN7O3 — CID 55880429
N'-[1-(3-chlorophenyl)-5-methyltriazole-4-carbonyl]-4-oxo-3-pentylphthalazine-1-carbohydrazide (PubChem CID 55880429) has the molecular formula C24H24ClN7O3 and a molecular weight of 493.96 g/mol. Its IUPAC name is N'-[1-(3-chlorophenyl)-5-methyltriazole-4-carbonyl]-4-oxo-3-pentylphthalazine-1-carbohydrazide.
| Compound Name | N'-[1-(3-chlorophenyl)-5-methyltriazole-4-carbonyl]-4-oxo-3-pentylphthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 55880429 |
| Molecular Formula | C24H24ClN7O3 |
| Molecular Weight | 493.96 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | N'-[1-(3-chlorophenyl)-5-methyltriazole-4-carbonyl]-4-oxo-3-pentylphthalazine-1-carbohydrazide |
| SMILES | CCCCCn1nc(C(=O)NNC(=O)c2nnn(-c3cccc(Cl)c3)c2C)c2ccccc2c1=O |
| InChI | InChI=1S/C24H24ClN7O3/c1-3-4-7-13-31-24(35)19-12-6-5-11-18(19)21(29-31)23(34)28-27-22(33)20-15(2)32(30-26-20)17-10-8-9-16(25)14-17/h5-6,8-12,14H,3-4,7,13H2,1-2H3,(H,27,33)(H,28,34) |
| InChIKey | BVSTWZUWHQKMGE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 123.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.96 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|