C21H30N4O3S — CID 55923112
N'-(2-butylsulfanylpropanoyl)-4-oxo-3-pentylphthalazine-1-carbohydrazide (PubChem CID 55923112) has the molecular formula C21H30N4O3S and a molecular weight of 418.56 g/mol. Its IUPAC name is N'-(2-butylsulfanylpropanoyl)-4-oxo-3-pentylphthalazine-1-carbohydrazide.
| Compound Name | N'-(2-butylsulfanylpropanoyl)-4-oxo-3-pentylphthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 55923112 |
| Molecular Formula | C21H30N4O3S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N'-(2-butylsulfanylpropanoyl)-4-oxo-3-pentylphthalazine-1-carbohydrazide |
| SMILES | CCCCCn1nc(C(=O)NNC(=O)C(C)SCCCC)c2ccccc2c1=O |
| InChI | InChI=1S/C21H30N4O3S/c1-4-6-10-13-25-21(28)17-12-9-8-11-16(17)18(24-25)20(27)23-22-19(26)15(3)29-14-7-5-2/h8-9,11-12,15H,4-7,10,13-14H2,1-3H3,(H,22,26)(H,23,27) |
| InChIKey | DWHOZJFOUWKGAR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|