C22H24N4O4 — CID 26889959
N'-(2-methoxybenzoyl)-4-oxo-3-pentylphthalazine-1-carbohydrazide (PubChem CID 26889959) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is N'-(2-methoxybenzoyl)-4-oxo-3-pentylphthalazine-1-carbohydrazide.
| Compound Name | N'-(2-methoxybenzoyl)-4-oxo-3-pentylphthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 26889959 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N'-(2-methoxybenzoyl)-4-oxo-3-pentylphthalazine-1-carbohydrazide |
| SMILES | CCCCCn1nc(C(=O)NNC(=O)c2ccccc2OC)c2ccccc2c1=O |
| InChI | InChI=1S/C22H24N4O4/c1-3-4-9-14-26-22(29)16-11-6-5-10-15(16)19(25-26)21(28)24-23-20(27)17-12-7-8-13-18(17)30-2/h5-8,10-13H,3-4,9,14H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | AYQLDXQVYSFQHK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|