C21H24N4O5S — CID 26950404
N'-(4-methoxyphenyl)sulfonyl-4-oxo-3-pentylphthalazine-1-carbohydrazide (PubChem CID 26950404) has the molecular formula C21H24N4O5S and a molecular weight of 444.51 g/mol. Its IUPAC name is N'-(4-methoxyphenyl)sulfonyl-4-oxo-3-pentylphthalazine-1-carbohydrazide.
| Compound Name | N'-(4-methoxyphenyl)sulfonyl-4-oxo-3-pentylphthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 26950404 |
| Molecular Formula | C21H24N4O5S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | N'-(4-methoxyphenyl)sulfonyl-4-oxo-3-pentylphthalazine-1-carbohydrazide |
| SMILES | CCCCCn1nc(C(=O)NNS(=O)(=O)c2ccc(OC)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H24N4O5S/c1-3-4-7-14-25-21(27)18-9-6-5-8-17(18)19(23-25)20(26)22-24-31(28,29)16-12-10-15(30-2)11-13-16/h5-6,8-13,24H,3-4,7,14H2,1-2H3,(H,22,26) |
| InChIKey | UUUFBMSTZQDPKB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|