C18H18N4O6S2 — CID 24563195
methyl 3-[[(4-oxo-3-propylphthalazine-1-carbonyl)amino]sulfamoyl]thiophene-2-carboxylate (PubChem CID 24563195) has the molecular formula C18H18N4O6S2 and a molecular weight of 450.50 g/mol. Its IUPAC name is methyl 3-[[(4-oxo-3-propylphthalazine-1-carbonyl)amino]sulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[(4-oxo-3-propylphthalazine-1-carbonyl)amino]sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 24563195 |
| Molecular Formula | C18H18N4O6S2 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | methyl 3-[[(4-oxo-3-propylphthalazine-1-carbonyl)amino]sulfamoyl]thiophene-2-carboxylate |
| SMILES | CCCn1nc(C(=O)NNS(=O)(=O)c2ccsc2C(=O)OC)c2ccccc2c1=O |
| InChI | InChI=1S/C18H18N4O6S2/c1-3-9-22-17(24)12-7-5-4-6-11(12)14(20-22)16(23)19-21-30(26,27)13-8-10-29-15(13)18(25)28-2/h4-8,10,21H,3,9H2,1-2H3,(H,19,23) |
| InChIKey | VUHBMBLWSLWSQZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 136.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|